About N-benzyl-N-[(5-chloro-1,3-benzoxazol-2-yl)methyl]-3,4-difluorobenzamide
N-benzyl-N-[(5-chloro-1,3-benzoxazol-2-yl)methyl]-3,4-difluorobenzamide (PubChem CID 46099551) has the molecular formula C22H15ClF2N2O2
and a molecular weight of 412.82 g/mol. Its IUPAC name is N-benzyl-N-[(5-chloro-1,3-benzoxazol-2-yl)methyl]-3,4-difluorobenzamide.
Molecular Properties
| Compound Name | N-benzyl-N-[(5-chloro-1,3-benzoxazol-2-yl)methyl]-3,4-difluorobenzamide |
| PubChem CID | 46099551 |
| Molecular Formula | C22H15ClF2N2O2 |
| Molecular Weight | 412.82 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | N-benzyl-N-[(5-chloro-1,3-benzoxazol-2-yl)methyl]-3,4-difluorobenzamide |
| SMILES | O=C(c1ccc(F)c(F)c1)N(Cc1ccccc1)Cc1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C22H15ClF2N2O2/c23-16-7-9-20-19(11-16)26-21(29-20)13-27(12-14-4-2-1-3-5-14)22(28)15-6-8-17(24)18(25)10-15/h1-11H,12-13H2 |
| InChIKey | MOCOCSXHDAFZJZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.82 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-N-[(5-chloro-1,3-benzoxazol-2-yl)methyl]-3,4-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-[(5-chloro-1,3-benzoxazol-2-yl)methyl]-3,4-difluorobenzamide?
The IUPAC name of N-benzyl-N-[(5-chloro-1,3-benzoxazol-2-yl)methyl]-3,4-difluorobenzamide (CID 46099551) is N-benzyl-N-[(5-chloro-1,3-benzoxazol-2-yl)methyl]-3,4-difluorobenzamide.
What is the SMILES notation for N-benzyl-N-[(5-chloro-1,3-benzoxazol-2-yl)methyl]-3,4-difluorobenzamide?
The canonical SMILES for N-benzyl-N-[(5-chloro-1,3-benzoxazol-2-yl)methyl]-3,4-difluorobenzamide is O=C(c1ccc(F)c(F)c1)N(Cc1ccccc1)Cc1nc2cc(Cl)ccc2o1.
What is the InChIKey of N-benzyl-N-[(5-chloro-1,3-benzoxazol-2-yl)methyl]-3,4-difluorobenzamide?
The InChIKey is MOCOCSXHDAFZJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15ClF2N2O2/c23-16-7-9-20-19(11-16)26-21(29-20)13-27(12-14-4-2-1-3-5-14)22(28)15-6-8-17(24)18(25)10-15/h1-11H,12-13H2.
What are the key properties of N-benzyl-N-[(5-chloro-1,3-benzoxazol-2-yl)methyl]-3,4-difluorobenzamide?
N-benzyl-N-[(5-chloro-1,3-benzoxazol-2-yl)methyl]-3,4-difluorobenzamide has a molecular weight of 412.82 g/mol, XLogP of 5.60, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-[(5-chloro-1,3-benzoxazol-2-yl)methyl]-3,4-difluorobenzamide is sourced from PubChem (CID 46099551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).