C21H14Cl3N3O2 — CID 46099567
6-chloro-N-[(5-chloro-1,3-benzoxazol-2-yl)methyl]-N-[(3-chlorophenyl)methyl]pyridine-3-carboxamide (PubChem CID 46099567) has the molecular formula C21H14Cl3N3O2 and a molecular weight of 446.72 g/mol. Its IUPAC name is 6-chloro-N-[(5-chloro-1,3-benzoxazol-2-yl)methyl]-N-[(3-chlorophenyl)methyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[(5-chloro-1,3-benzoxazol-2-yl)methyl]-N-[(3-chlorophenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46099567 |
| Molecular Formula | C21H14Cl3N3O2 |
| Molecular Weight | 446.72 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 6-chloro-N-[(5-chloro-1,3-benzoxazol-2-yl)methyl]-N-[(3-chlorophenyl)methyl]pyridine-3-carboxamide |
| SMILES | O=C(c1ccc(Cl)nc1)N(Cc1cccc(Cl)c1)Cc1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C21H14Cl3N3O2/c22-15-3-1-2-13(8-15)11-27(21(28)14-4-7-19(24)25-10-14)12-20-26-17-9-16(23)5-6-18(17)29-20/h1-10H,11-12H2 |
| InChIKey | LRAYSIDVKQOZAV-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.72 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|