C22H25FN2O5 — CID 46100288
benzyl N-[1-[2-[(4-fluorophenoxy)methyl]morpholin-4-yl]-1-oxopropan-2-yl]carbamate (PubChem CID 46100288) has the molecular formula C22H25FN2O5 and a molecular weight of 416.45 g/mol. Its IUPAC name is benzyl N-[1-[2-[(4-fluorophenoxy)methyl]morpholin-4-yl]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[2-[(4-fluorophenoxy)methyl]morpholin-4-yl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 46100288 |
| Molecular Formula | C22H25FN2O5 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | benzyl N-[1-[2-[(4-fluorophenoxy)methyl]morpholin-4-yl]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(NC(=O)OCc1ccccc1)C(=O)N1CCOC(COc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H25FN2O5/c1-16(24-22(27)30-14-17-5-3-2-4-6-17)21(26)25-11-12-28-20(13-25)15-29-19-9-7-18(23)8-10-19/h2-10,16,20H,11-15H2,1H3,(H,24,27) |
| InChIKey | RIIIROVKWUVUEG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |