C26H32N2O3S — CID 46100892
4-(azocan-1-ylmethyl)-2-[3-(2,3,4-trimethoxyphenyl)phenyl]-1,3-thiazole (PubChem CID 46100892) has the molecular formula C26H32N2O3S and a molecular weight of 452.62 g/mol. Its IUPAC name is 4-(azocan-1-ylmethyl)-2-[3-(2,3,4-trimethoxyphenyl)phenyl]-1,3-thiazole.
| Compound Name | 4-(azocan-1-ylmethyl)-2-[3-(2,3,4-trimethoxyphenyl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 46100892 |
| Molecular Formula | C26H32N2O3S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 4-(azocan-1-ylmethyl)-2-[3-(2,3,4-trimethoxyphenyl)phenyl]-1,3-thiazole |
| SMILES | COc1ccc(-c2cccc(-c3nc(CN4CCCCCCC4)cs3)c2)c(OC)c1OC |
| InChI | InChI=1S/C26H32N2O3S/c1-29-23-13-12-22(24(30-2)25(23)31-3)19-10-9-11-20(16-19)26-27-21(18-32-26)17-28-14-7-5-4-6-8-15-28/h9-13,16,18H,4-8,14-15,17H2,1-3H3 |
| InChIKey | HLTNPBWEFLJDRD-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |