C22H19F4NO3 — CID 46102398
methyl 2-[4-[[4-fluoro-2-(trifluoromethyl)benzoyl]amino]cyclopent-2-en-1-yl]-2-phenylacetate (PubChem CID 46102398) has the molecular formula C22H19F4NO3 and a molecular weight of 421.39 g/mol. Its IUPAC name is methyl 2-[4-[[4-fluoro-2-(trifluoromethyl)benzoyl]amino]cyclopent-2-en-1-yl]-2-phenylacetate.
| Compound Name | methyl 2-[4-[[4-fluoro-2-(trifluoromethyl)benzoyl]amino]cyclopent-2-en-1-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 46102398 |
| Molecular Formula | C22H19F4NO3 |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | methyl 2-[4-[[4-fluoro-2-(trifluoromethyl)benzoyl]amino]cyclopent-2-en-1-yl]-2-phenylacetate |
| SMILES | COC(=O)C(c1ccccc1)C1C=CC(NC(=O)c2ccc(F)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C22H19F4NO3/c1-30-21(29)19(13-5-3-2-4-6-13)14-7-9-16(11-14)27-20(28)17-10-8-15(23)12-18(17)22(24,25)26/h2-10,12,14,16,19H,11H2,1H3,(H,27,28) |
| InChIKey | DRKIRKVHIYEXIW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|