C28H20F3N3O6 — CID 46102981
[6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(5-nitrofuran-2-yl)methanone (PubChem CID 46102981) has the molecular formula C28H20F3N3O6 and a molecular weight of 551.48 g/mol. Its IUPAC name is [6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(5-nitrofuran-2-yl)methanone.
| Compound Name | [6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(5-nitrofuran-2-yl)methanone |
|---|---|
| PubChem CID | 46102981 |
| Molecular Formula | C28H20F3N3O6 |
| Molecular Weight | 551.48 g/mol |
| Exact Mass | 551.13 |
| IUPAC Name | [6-methoxy-1-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(5-nitrofuran-2-yl)methanone |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(C(=O)c1ccc([N+](=O)[O-])o1)C3c1ccc(-c2ccccc2C(F)(F)F)o1 |
| InChI | InChI=1S/C28H20F3N3O6/c1-38-15-6-7-20-18(14-15)16-12-13-33(27(35)23-10-11-24(40-23)34(36)37)26(25(16)32-20)22-9-8-21(39-22)17-4-2-3-5-19(17)28(29,30)31/h2-11,14,26,32H,12-13H2,1H3 |
| InChIKey | HAAZNOUQOQYBCN-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 114.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.48 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|