C29H27F5N4O4 — CID 46103296
N-(4-methoxyphenyl)-1-[(2R)-2-[(2,3,4,5,6-pentafluorophenyl)carbamoylamino]-3-phenylpropanoyl]piperidine-4-carboxamide (PubChem CID 46103296) has the molecular formula C29H27F5N4O4 and a molecular weight of 590.55 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-1-[(2R)-2-[(2,3,4,5,6-pentafluorophenyl)carbamoylamino]-3-phenylpropanoyl]piperidine-4-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-1-[(2R)-2-[(2,3,4,5,6-pentafluorophenyl)carbamoylamino]-3-phenylpropanoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46103296 |
| Molecular Formula | C29H27F5N4O4 |
| Molecular Weight | 590.55 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | N-(4-methoxyphenyl)-1-[(2R)-2-[(2,3,4,5,6-pentafluorophenyl)carbamoylamino]-3-phenylpropanoyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCN(C(=O)[C@@H](Cc3ccccc3)NC(=O)Nc3c(F)c(F)c(F)c(F)c3F)CC2)cc1 |
| InChI | InChI=1S/C29H27F5N4O4/c1-42-19-9-7-18(8-10-19)35-27(39)17-11-13-38(14-12-17)28(40)20(15-16-5-3-2-4-6-16)36-29(41)37-26-24(33)22(31)21(30)23(32)25(26)34/h2-10,17,20H,11-15H2,1H3,(H,35,39)(H2,36,37,41)/t20-/m1/s1 |
| InChIKey | IZYCWWXBMUQJDQ-HXUWFJFHSA-N |
| XLogP | 5.00 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|