C26H29F7N2O4 — CID 46103432
5-[(4-tert-butylphenyl)methoxy]-2-[[4-(2,2,3,3,4,4,4-heptafluorobutanoyl)-1,4-diazepan-1-yl]methyl]pyran-4-one (PubChem CID 46103432) has the molecular formula C26H29F7N2O4 and a molecular weight of 566.51 g/mol. Its IUPAC name is 5-[(4-tert-butylphenyl)methoxy]-2-[[4-(2,2,3,3,4,4,4-heptafluorobutanoyl)-1,4-diazepan-1-yl]methyl]pyran-4-one.
| Compound Name | 5-[(4-tert-butylphenyl)methoxy]-2-[[4-(2,2,3,3,4,4,4-heptafluorobutanoyl)-1,4-diazepan-1-yl]methyl]pyran-4-one |
|---|---|
| PubChem CID | 46103432 |
| Molecular Formula | C26H29F7N2O4 |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | 5-[(4-tert-butylphenyl)methoxy]-2-[[4-(2,2,3,3,4,4,4-heptafluorobutanoyl)-1,4-diazepan-1-yl]methyl]pyran-4-one |
| SMILES | CC(C)(C)c1ccc(COc2coc(CN3CCCN(C(=O)C(F)(F)C(F)(F)C(F)(F)F)CC3)cc2=O)cc1 |
| InChI | InChI=1S/C26H29F7N2O4/c1-23(2,3)18-7-5-17(6-8-18)15-39-21-16-38-19(13-20(21)36)14-34-9-4-10-35(12-11-34)22(37)24(27,28)25(29,30)26(31,32)33/h5-8,13,16H,4,9-12,14-15H2,1-3H3 |
| InChIKey | DNHWBGPHVPPWAQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|