C17H15FN4O — CID 46104880
5-(3-fluorophenyl)-1-methyl-N-(pyridin-2-ylmethyl)pyrazole-3-carboxamide (PubChem CID 46104880) has the molecular formula C17H15FN4O and a molecular weight of 310.33 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-1-methyl-N-(pyridin-2-ylmethyl)pyrazole-3-carboxamide.
| Compound Name | 5-(3-fluorophenyl)-1-methyl-N-(pyridin-2-ylmethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 46104880 |
| Molecular Formula | C17H15FN4O |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 5-(3-fluorophenyl)-1-methyl-N-(pyridin-2-ylmethyl)pyrazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)NCc2ccccn2)cc1-c1cccc(F)c1 |
| InChI | InChI=1S/C17H15FN4O/c1-22-16(12-5-4-6-13(18)9-12)10-15(21-22)17(23)20-11-14-7-2-3-8-19-14/h2-10H,11H2,1H3,(H,20,23) |
| InChIKey | CSFWJXYMXMMVSM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |