C20H19FN4O3 — CID 46104888
[4-[5-(3-fluorophenyl)-1-methylpyrazole-3-carbonyl]piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 46104888) has the molecular formula C20H19FN4O3 and a molecular weight of 382.40 g/mol. Its IUPAC name is [4-[5-(3-fluorophenyl)-1-methylpyrazole-3-carbonyl]piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[5-(3-fluorophenyl)-1-methylpyrazole-3-carbonyl]piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 46104888 |
| Molecular Formula | C20H19FN4O3 |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | [4-[5-(3-fluorophenyl)-1-methylpyrazole-3-carbonyl]piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | Cn1nc(C(=O)N2CCN(C(=O)c3ccco3)CC2)cc1-c1cccc(F)c1 |
| InChI | InChI=1S/C20H19FN4O3/c1-23-17(14-4-2-5-15(21)12-14)13-16(22-23)19(26)24-7-9-25(10-8-24)20(27)18-6-3-11-28-18/h2-6,11-13H,7-10H2,1H3 |
| InChIKey | UKJQVHPKNMUFMN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 71.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |