C31H37N3O4S — CID 46108714
2-[benzenesulfonyl(propyl)amino]-N-benzyl-N-[1-(2-phenylacetyl)piperidin-4-yl]acetamide (PubChem CID 46108714) has the molecular formula C31H37N3O4S and a molecular weight of 547.72 g/mol. Its IUPAC name is 2-[benzenesulfonyl(propyl)amino]-N-benzyl-N-[1-(2-phenylacetyl)piperidin-4-yl]acetamide.
| Compound Name | 2-[benzenesulfonyl(propyl)amino]-N-benzyl-N-[1-(2-phenylacetyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 46108714 |
| Molecular Formula | C31H37N3O4S |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | 2-[benzenesulfonyl(propyl)amino]-N-benzyl-N-[1-(2-phenylacetyl)piperidin-4-yl]acetamide |
| SMILES | CCCN(CC(=O)N(Cc1ccccc1)C1CCN(C(=O)Cc2ccccc2)CC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H37N3O4S/c1-2-20-33(39(37,38)29-16-10-5-11-17-29)25-31(36)34(24-27-14-8-4-9-15-27)28-18-21-32(22-19-28)30(35)23-26-12-6-3-7-13-26/h3-17,28H,2,18-25H2,1H3 |
| InChIKey | CRHUVULRYDKWNR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |