C26H35N3O5S — CID 46108750
2-[benzenesulfonyl(propyl)amino]-N-benzyl-N-[1-(2-methoxyacetyl)piperidin-4-yl]acetamide (PubChem CID 46108750) has the molecular formula C26H35N3O5S and a molecular weight of 501.65 g/mol. Its IUPAC name is 2-[benzenesulfonyl(propyl)amino]-N-benzyl-N-[1-(2-methoxyacetyl)piperidin-4-yl]acetamide.
| Compound Name | 2-[benzenesulfonyl(propyl)amino]-N-benzyl-N-[1-(2-methoxyacetyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 46108750 |
| Molecular Formula | C26H35N3O5S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 2-[benzenesulfonyl(propyl)amino]-N-benzyl-N-[1-(2-methoxyacetyl)piperidin-4-yl]acetamide |
| SMILES | CCCN(CC(=O)N(Cc1ccccc1)C1CCN(C(=O)COC)CC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H35N3O5S/c1-3-16-28(35(32,33)24-12-8-5-9-13-24)20-25(30)29(19-22-10-6-4-7-11-22)23-14-17-27(18-15-23)26(31)21-34-2/h4-13,23H,3,14-21H2,1-2H3 |
| InChIKey | DCXFXGZJVLFJIM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |