C28H46ClN3O5S — CID 46108795
N-[(3-chlorophenyl)methyl]-2-[2-methoxyethyl(propylsulfonyl)amino]-N-(1-octanoylpiperidin-4-yl)acetamide (PubChem CID 46108795) has the molecular formula C28H46ClN3O5S and a molecular weight of 572.21 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-2-[2-methoxyethyl(propylsulfonyl)amino]-N-(1-octanoylpiperidin-4-yl)acetamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-2-[2-methoxyethyl(propylsulfonyl)amino]-N-(1-octanoylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 46108795 |
| Molecular Formula | C28H46ClN3O5S |
| Molecular Weight | 572.21 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-2-[2-methoxyethyl(propylsulfonyl)amino]-N-(1-octanoylpiperidin-4-yl)acetamide |
| SMILES | CCCCCCCC(=O)N1CCC(N(Cc2cccc(Cl)c2)C(=O)CN(CCOC)S(=O)(=O)CCC)CC1 |
| InChI | InChI=1S/C28H46ClN3O5S/c1-4-6-7-8-9-13-27(33)30-16-14-26(15-17-30)32(22-24-11-10-12-25(29)21-24)28(34)23-31(18-19-37-3)38(35,36)20-5-2/h10-12,21,26H,4-9,13-20,22-23H2,1-3H3 |
| InChIKey | AAOLOXVFBANKHL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.21 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|