C25H41FN4O4S — CID 46108893
N-butyl-4-[(4-fluorophenyl)methyl-[2-[propyl(propylsulfonyl)amino]acetyl]amino]piperidine-1-carboxamide (PubChem CID 46108893) has the molecular formula C25H41FN4O4S and a molecular weight of 512.69 g/mol. Its IUPAC name is N-butyl-4-[(4-fluorophenyl)methyl-[2-[propyl(propylsulfonyl)amino]acetyl]amino]piperidine-1-carboxamide.
| Compound Name | N-butyl-4-[(4-fluorophenyl)methyl-[2-[propyl(propylsulfonyl)amino]acetyl]amino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 46108893 |
| Molecular Formula | C25H41FN4O4S |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | N-butyl-4-[(4-fluorophenyl)methyl-[2-[propyl(propylsulfonyl)amino]acetyl]amino]piperidine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCC(N(Cc2ccc(F)cc2)C(=O)CN(CCC)S(=O)(=O)CCC)CC1 |
| InChI | InChI=1S/C25H41FN4O4S/c1-4-7-14-27-25(32)28-16-12-23(13-17-28)30(19-21-8-10-22(26)11-9-21)24(31)20-29(15-5-2)35(33,34)18-6-3/h8-11,23H,4-7,12-20H2,1-3H3,(H,27,32) |
| InChIKey | QAUHOHYZQVDNKW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|