C18H16Cl2N2O4 — CID 46111591
2,2-dichloro-N-(furan-2-ylmethyl)-N-[[5-(2-methoxyphenyl)-1,2-oxazol-3-yl]methyl]acetamide (PubChem CID 46111591) has the molecular formula C18H16Cl2N2O4 and a molecular weight of 395.24 g/mol. Its IUPAC name is 2,2-dichloro-N-(furan-2-ylmethyl)-N-[[5-(2-methoxyphenyl)-1,2-oxazol-3-yl]methyl]acetamide.
| Compound Name | 2,2-dichloro-N-(furan-2-ylmethyl)-N-[[5-(2-methoxyphenyl)-1,2-oxazol-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 46111591 |
| Molecular Formula | C18H16Cl2N2O4 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 2,2-dichloro-N-(furan-2-ylmethyl)-N-[[5-(2-methoxyphenyl)-1,2-oxazol-3-yl]methyl]acetamide |
| SMILES | COc1ccccc1-c1cc(CN(Cc2ccco2)C(=O)C(Cl)Cl)no1 |
| InChI | InChI=1S/C18H16Cl2N2O4/c1-24-15-7-3-2-6-14(15)16-9-12(21-26-16)10-22(18(23)17(19)20)11-13-5-4-8-25-13/h2-9,17H,10-11H2,1H3 |
| InChIKey | BZCLQAQNJCMASN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 68.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|