C17H11N3O — CID 4611263
imidazo[1,2-a]pyrimidin-3-yl(naphthalen-2-yl)methanone (PubChem CID 4611263) has the molecular formula C17H11N3O and a molecular weight of 273.30 g/mol. Its IUPAC name is imidazo[1,2-a]pyrimidin-3-yl(naphthalen-2-yl)methanone.
| Compound Name | imidazo[1,2-a]pyrimidin-3-yl(naphthalen-2-yl)methanone |
|---|---|
| PubChem CID | 4611263 |
| Molecular Formula | C17H11N3O |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | imidazo[1,2-a]pyrimidin-3-yl(naphthalen-2-yl)methanone |
| SMILES | O=C(c1ccc2ccccc2c1)c1cnc2ncccn12 |
| InChI | InChI=1S/C17H11N3O/c21-16(15-11-19-17-18-8-3-9-20(15)17)14-7-6-12-4-1-2-5-13(12)10-14/h1-11H |
| InChIKey | CBRFYXFJRJDWRR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |