C17H23N3O3 — CID 4611826
2-hydroxy-3-methyl-N'-(4-oxo-4-piperidin-1-ylbut-1-en-2-yl)benzohydrazide (PubChem CID 4611826) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-hydroxy-3-methyl-N'-(4-oxo-4-piperidin-1-ylbut-1-en-2-yl)benzohydrazide.
| Compound Name | 2-hydroxy-3-methyl-N'-(4-oxo-4-piperidin-1-ylbut-1-en-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 4611826 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 2-hydroxy-3-methyl-N'-(4-oxo-4-piperidin-1-ylbut-1-en-2-yl)benzohydrazide |
| SMILES | C=C(CC(=O)N1CCCCC1)NNC(=O)c1cccc(C)c1O |
| InChI | InChI=1S/C17H23N3O3/c1-12-7-6-8-14(16(12)22)17(23)19-18-13(2)11-15(21)20-9-4-3-5-10-20/h6-8,18,22H,2-5,9-11H2,1H3,(H,19,23) |
| InChIKey | NEJPTEKXFCPYLY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|