C9H8ClN5O2 — CID 4611888
[1-[(4-chlorophenyl)methyl]-1,2,4-triazol-4-ium-4-yl]-nitroazanide (PubChem CID 4611888) has the molecular formula C9H8ClN5O2 and a molecular weight of 253.65 g/mol. Its IUPAC name is [1-[(4-chlorophenyl)methyl]-1,2,4-triazol-4-ium-4-yl]-nitroazanide.
| Compound Name | [1-[(4-chlorophenyl)methyl]-1,2,4-triazol-4-ium-4-yl]-nitroazanide |
|---|---|
| PubChem CID | 4611888 |
| Molecular Formula | C9H8ClN5O2 |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | [1-[(4-chlorophenyl)methyl]-1,2,4-triazol-4-ium-4-yl]-nitroazanide |
| SMILES | O=[N+]([O-])[N-][n+]1cnn(Cc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C9H8ClN5O2/c10-9-3-1-8(2-4-9)5-13-7-14(6-11-13)12-15(16)17/h1-4,6-7H,5H2 |
| InChIKey | MJJUAAVBCAZFOR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 78.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|