C25H24N2O4 — CID 4612346
[2-[4-(dimethylazaniumyl)phenyl]-1-(furan-2-ylmethyl)-4,5-dioxopyrrolidin-3-ylidene]-(4-methylphenyl)methanolate (PubChem CID 4612346) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is [2-[4-(dimethylazaniumyl)phenyl]-1-(furan-2-ylmethyl)-4,5-dioxopyrrolidin-3-ylidene]-(4-methylphenyl)methanolate.
| Compound Name | [2-[4-(dimethylazaniumyl)phenyl]-1-(furan-2-ylmethyl)-4,5-dioxopyrrolidin-3-ylidene]-(4-methylphenyl)methanolate |
|---|---|
| PubChem CID | 4612346 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | [2-[4-(dimethylazaniumyl)phenyl]-1-(furan-2-ylmethyl)-4,5-dioxopyrrolidin-3-ylidene]-(4-methylphenyl)methanolate |
| SMILES | Cc1ccc(C([O-])=C2C(=O)C(=O)N(Cc3ccco3)C2c2ccc([NH+](C)C)cc2)cc1 |
| InChI | InChI=1S/C25H24N2O4/c1-16-6-8-18(9-7-16)23(28)21-22(17-10-12-19(13-11-17)26(2)3)27(25(30)24(21)29)15-20-5-4-14-31-20/h4-14,22,28H,15H2,1-3H3 |
| InChIKey | RBOABXIOAVVRMY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 78.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|