C31H35NO5 — CID 4635077
5-(3,5-ditert-butyl-4-hydroxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-(4-methylphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 4635077) has the molecular formula C31H35NO5 and a molecular weight of 501.62 g/mol. Its IUPAC name is 5-(3,5-ditert-butyl-4-hydroxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-(4-methylphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | 5-(3,5-ditert-butyl-4-hydroxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-(4-methylphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4635077 |
| Molecular Formula | C31H35NO5 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | 5-(3,5-ditert-butyl-4-hydroxyphenyl)-1-(furan-2-ylmethyl)-4-[hydroxy-(4-methylphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(C(O)=C2C(=O)C(=O)N(Cc3ccco3)C2c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C31H35NO5/c1-18-10-12-19(13-11-18)26(33)24-25(32(29(36)28(24)35)17-21-9-8-14-37-21)20-15-22(30(2,3)4)27(34)23(16-20)31(5,6)7/h8-16,25,33-34H,17H2,1-7H3 |
| InChIKey | UIBDJHOWPCJIJI-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|