C32H37NO6 — CID 4635081
5-(3,5-ditert-butyl-4-hydroxyphenyl)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 4635081) has the molecular formula C32H37NO6 and a molecular weight of 531.65 g/mol. Its IUPAC name is 5-(3,5-ditert-butyl-4-hydroxyphenyl)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(3,5-ditert-butyl-4-hydroxyphenyl)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4635081 |
| Molecular Formula | C32H37NO6 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | 5-(3,5-ditert-butyl-4-hydroxyphenyl)-4-[(4-ethoxyphenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(C(O)=C2C(=O)C(=O)N(Cc3ccco3)C2c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C32H37NO6/c1-8-38-21-13-11-19(12-14-21)27(34)25-26(33(30(37)29(25)36)18-22-10-9-15-39-22)20-16-23(31(2,3)4)28(35)24(17-20)32(5,6)7/h9-17,26,34-35H,8,18H2,1-7H3 |
| InChIKey | XKPSOXULXOIFAE-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|