C24H29N5O5 — CID 46150931
1-[benzyl-[2-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]ethyl]amino]-3-morpholin-4-ylpropan-2-ol (PubChem CID 46150931) has the molecular formula C24H29N5O5 and a molecular weight of 467.53 g/mol. Its IUPAC name is 1-[benzyl-[2-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]ethyl]amino]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | 1-[benzyl-[2-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]ethyl]amino]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 46150931 |
| Molecular Formula | C24H29N5O5 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 1-[benzyl-[2-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]ethyl]amino]-3-morpholin-4-ylpropan-2-ol |
| SMILES | O=[N+]([O-])c1ccc(-c2noc(CCN(Cc3ccccc3)CC(O)CN3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C24H29N5O5/c30-22(17-27-12-14-33-15-13-27)18-28(16-19-4-2-1-3-5-19)11-10-23-25-24(26-34-23)20-6-8-21(9-7-20)29(31)32/h1-9,22,30H,10-18H2 |
| InChIKey | ASANYJKRQTVVQR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|