C26H22N4O4 — CID 83279134
(E)-N-benzyl-N-[2-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-phenylprop-2-enamide (PubChem CID 83279134) has the molecular formula C26H22N4O4 and a molecular weight of 454.49 g/mol. Its IUPAC name is (E)-N-benzyl-N-[2-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-benzyl-N-[2-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 83279134 |
| Molecular Formula | C26H22N4O4 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | (E)-N-benzyl-N-[2-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)N(CCc1nc(-c2ccc([N+](=O)[O-])cc2)no1)Cc1ccccc1 |
| InChI | InChI=1S/C26H22N4O4/c31-25(16-11-20-7-3-1-4-8-20)29(19-21-9-5-2-6-10-21)18-17-24-27-26(28-34-24)22-12-14-23(15-13-22)30(32)33/h1-16H,17-19H2/b16-11+ |
| InChIKey | PEQTXFFQIHUPGK-LFIBNONCSA-N |
| XLogP | 4.93 |
| TPSA | 102.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|