C22H28F3N3O2 — CID 46153005
2-cyclopentyl-N-prop-2-enyl-2-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]acetamide (PubChem CID 46153005) has the molecular formula C22H28F3N3O2 and a molecular weight of 423.48 g/mol. Its IUPAC name is 2-cyclopentyl-N-prop-2-enyl-2-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]acetamide.
| Compound Name | 2-cyclopentyl-N-prop-2-enyl-2-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 46153005 |
| Molecular Formula | C22H28F3N3O2 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 2-cyclopentyl-N-prop-2-enyl-2-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]acetamide |
| SMILES | C=CCNC(=O)C(C1CCCC1)N1CCN(C(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H28F3N3O2/c1-2-11-26-20(29)19(16-5-3-4-6-16)27-12-14-28(15-13-27)21(30)17-7-9-18(10-8-17)22(23,24)25/h2,7-10,16,19H,1,3-6,11-15H2,(H,26,29) |
| InChIKey | OCLFTNNSHVVGPK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|