C25H28N2O4S — CID 46161824
N-[1-[(2-hydroxy-3-methoxyphenyl)methyl]piperidin-4-yl]-N-(3-methoxyphenyl)thiophene-2-carboxamide (PubChem CID 46161824) has the molecular formula C25H28N2O4S and a molecular weight of 452.58 g/mol. Its IUPAC name is N-[1-[(2-hydroxy-3-methoxyphenyl)methyl]piperidin-4-yl]-N-(3-methoxyphenyl)thiophene-2-carboxamide.
| Compound Name | N-[1-[(2-hydroxy-3-methoxyphenyl)methyl]piperidin-4-yl]-N-(3-methoxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46161824 |
| Molecular Formula | C25H28N2O4S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | N-[1-[(2-hydroxy-3-methoxyphenyl)methyl]piperidin-4-yl]-N-(3-methoxyphenyl)thiophene-2-carboxamide |
| SMILES | COc1cccc(N(C(=O)c2cccs2)C2CCN(Cc3cccc(OC)c3O)CC2)c1 |
| InChI | InChI=1S/C25H28N2O4S/c1-30-21-8-4-7-20(16-21)27(25(29)23-10-5-15-32-23)19-11-13-26(14-12-19)17-18-6-3-9-22(31-2)24(18)28/h3-10,15-16,19,28H,11-14,17H2,1-2H3 |
| InChIKey | UTZWWYKTEZPIQH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|