C22H19F3N2O3S — CID 46165058
2-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]-N-prop-2-enyl-1,3-thiazole-4-carboxamide (PubChem CID 46165058) has the molecular formula C22H19F3N2O3S and a molecular weight of 448.47 g/mol. Its IUPAC name is 2-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]-N-prop-2-enyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]-N-prop-2-enyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46165058 |
| Molecular Formula | C22H19F3N2O3S |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 2-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]-N-prop-2-enyl-1,3-thiazole-4-carboxamide |
| SMILES | C=CCNC(=O)c1csc(-c2ccc(OCc3cccc(C(F)(F)F)c3)c(OC)c2)n1 |
| InChI | InChI=1S/C22H19F3N2O3S/c1-3-9-26-20(28)17-13-31-21(27-17)15-7-8-18(19(11-15)29-2)30-12-14-5-4-6-16(10-14)22(23,24)25/h3-8,10-11,13H,1,9,12H2,2H3,(H,26,28) |
| InChIKey | JCNAQYILLZPUKT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|