C21H18Cl2N2O3S — CID 46165101
2-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-prop-2-enyl-1,3-thiazole-4-carboxamide (PubChem CID 46165101) has the molecular formula C21H18Cl2N2O3S and a molecular weight of 449.36 g/mol. Its IUPAC name is 2-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-prop-2-enyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-prop-2-enyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46165101 |
| Molecular Formula | C21H18Cl2N2O3S |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | 2-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-prop-2-enyl-1,3-thiazole-4-carboxamide |
| SMILES | C=CCNC(=O)c1csc(-c2ccc(OCc3ccc(Cl)c(Cl)c3)c(OC)c2)n1 |
| InChI | InChI=1S/C21H18Cl2N2O3S/c1-3-8-24-20(26)17-12-29-21(25-17)14-5-7-18(19(10-14)27-2)28-11-13-4-6-15(22)16(23)9-13/h3-7,9-10,12H,1,8,11H2,2H3,(H,24,26) |
| InChIKey | FZYWFYOZFWNXJK-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|