C24H27Cl2N3O2 — CID 46169517
5,6-dichloro-1'-(4-pentylbenzoyl)spiro[1,3-dihydroquinazoline-2,4'-piperidine]-4-one (PubChem CID 46169517) has the molecular formula C24H27Cl2N3O2 and a molecular weight of 460.41 g/mol. Its IUPAC name is 5,6-dichloro-1'-(4-pentylbenzoyl)spiro[1,3-dihydroquinazoline-2,4'-piperidine]-4-one.
| Compound Name | 5,6-dichloro-1'-(4-pentylbenzoyl)spiro[1,3-dihydroquinazoline-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 46169517 |
| Molecular Formula | C24H27Cl2N3O2 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 5,6-dichloro-1'-(4-pentylbenzoyl)spiro[1,3-dihydroquinazoline-2,4'-piperidine]-4-one |
| SMILES | CCCCCc1ccc(C(=O)N2CCC3(CC2)NC(=O)c2c(ccc(Cl)c2Cl)N3)cc1 |
| InChI | InChI=1S/C24H27Cl2N3O2/c1-2-3-4-5-16-6-8-17(9-7-16)23(31)29-14-12-24(13-15-29)27-19-11-10-18(25)21(26)20(19)22(30)28-24/h6-11,27H,2-5,12-15H2,1H3,(H,28,30) |
| InChIKey | LQGLQGTYXLWZHT-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|