C21H20N4O4S2 — CID 46174601
3-[5-[5-(2-methylimidazol-1-yl)thiophen-2-yl]-1-(4-sulfamoylphenyl)pyrrol-2-yl]propanoic acid (PubChem CID 46174601) has the molecular formula C21H20N4O4S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is 3-[5-[5-(2-methylimidazol-1-yl)thiophen-2-yl]-1-(4-sulfamoylphenyl)pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[5-[5-(2-methylimidazol-1-yl)thiophen-2-yl]-1-(4-sulfamoylphenyl)pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 46174601 |
| Molecular Formula | C21H20N4O4S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 3-[5-[5-(2-methylimidazol-1-yl)thiophen-2-yl]-1-(4-sulfamoylphenyl)pyrrol-2-yl]propanoic acid |
| SMILES | Cc1nccn1-c1ccc(-c2ccc(CCC(=O)O)n2-c2ccc(S(N)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C21H20N4O4S2/c1-14-23-12-13-24(14)20-10-9-19(30-20)18-8-4-16(5-11-21(26)27)25(18)15-2-6-17(7-3-15)31(22,28)29/h2-4,6-10,12-13H,5,11H2,1H3,(H,26,27)(H2,22,28,29) |
| InChIKey | KUVUKALCZPSOIJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 120.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|