C24H23N5O4S — CID 4617709
4-(dimethylsulfamoyl)-N-[4-[5-(4-methoxyphenyl)triazol-1-yl]phenyl]benzamide (PubChem CID 4617709) has the molecular formula C24H23N5O4S and a molecular weight of 477.55 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-[4-[5-(4-methoxyphenyl)triazol-1-yl]phenyl]benzamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-[4-[5-(4-methoxyphenyl)triazol-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 4617709 |
| Molecular Formula | C24H23N5O4S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-[4-[5-(4-methoxyphenyl)triazol-1-yl]phenyl]benzamide |
| SMILES | COc1ccc(-c2cnnn2-c2ccc(NC(=O)c3ccc(S(=O)(=O)N(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H23N5O4S/c1-28(2)34(31,32)22-14-6-18(7-15-22)24(30)26-19-8-10-20(11-9-19)29-23(16-25-27-29)17-4-12-21(33-3)13-5-17/h4-16H,1-3H3,(H,26,30) |
| InChIKey | BMFSALADOLYENT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |