C16H21NO — CID 46177807
[(1R,2S,10R,11R,12S)-5-methyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-trien-10-yl]methanol (PubChem CID 46177807) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is [(1R,2S,10R,11R,12S)-5-methyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-trien-10-yl]methanol.
| Compound Name | [(1R,2S,10R,11R,12S)-5-methyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-trien-10-yl]methanol |
|---|---|
| PubChem CID | 46177807 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | [(1R,2S,10R,11R,12S)-5-methyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-trien-10-yl]methanol |
| SMILES | Cc1ccc2c(c1)[C@H]1[C@@H]3CC[C@@H](C3)[C@H]1[C@H](CO)N2 |
| InChI | InChI=1S/C16H21NO/c1-9-2-5-13-12(6-9)15-10-3-4-11(7-10)16(15)14(8-18)17-13/h2,5-6,10-11,14-18H,3-4,7-8H2,1H3/t10-,11+,14+,15-,16+/m1/s1 |
| InChIKey | BLSFIZRRTQYQOM-ZEDHKUJTSA-N |
| XLogP | 2.91 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |