C22H30Cl2F2N4O2S — CID 46179115
2,6-dichloro-N-(difluoromethyl)-4-(4-piperidin-4-ylbutyl)-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide (PubChem CID 46179115) has the molecular formula C22H30Cl2F2N4O2S and a molecular weight of 523.48 g/mol. Its IUPAC name is 2,6-dichloro-N-(difluoromethyl)-4-(4-piperidin-4-ylbutyl)-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide.
| Compound Name | 2,6-dichloro-N-(difluoromethyl)-4-(4-piperidin-4-ylbutyl)-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 46179115 |
| Molecular Formula | C22H30Cl2F2N4O2S |
| Molecular Weight | 523.48 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | 2,6-dichloro-N-(difluoromethyl)-4-(4-piperidin-4-ylbutyl)-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide |
| SMILES | Cc1nn(C)c(C)c1N(C(F)F)S(=O)(=O)c1c(Cl)cc(CCCCC2CCNCC2)cc1Cl |
| InChI | InChI=1S/C22H30Cl2F2N4O2S/c1-14-20(15(2)29(3)28-14)30(22(25)26)33(31,32)21-18(23)12-17(13-19(21)24)7-5-4-6-16-8-10-27-11-9-16/h12-13,16,22,27H,4-11H2,1-3H3 |
| InChIKey | JEXUGPIZWWTQHG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|