C22H30Cl2F2N4O3S — CID 58561125
2,6-dichloro-N-(difluoromethyl)-4-[3-(1-methylpiperidin-4-yl)oxypropyl]-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide (PubChem CID 58561125) has the molecular formula C22H30Cl2F2N4O3S and a molecular weight of 539.48 g/mol. Its IUPAC name is 2,6-dichloro-N-(difluoromethyl)-4-[3-(1-methylpiperidin-4-yl)oxypropyl]-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide.
| Compound Name | 2,6-dichloro-N-(difluoromethyl)-4-[3-(1-methylpiperidin-4-yl)oxypropyl]-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 58561125 |
| Molecular Formula | C22H30Cl2F2N4O3S |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | 2,6-dichloro-N-(difluoromethyl)-4-[3-(1-methylpiperidin-4-yl)oxypropyl]-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide |
| SMILES | Cc1nn(C)c(C)c1N(C(F)F)S(=O)(=O)c1c(Cl)cc(CCCOC2CCN(C)CC2)cc1Cl |
| InChI | InChI=1S/C22H30Cl2F2N4O3S/c1-14-20(15(2)29(4)27-14)30(22(25)26)34(31,32)21-18(23)12-16(13-19(21)24)6-5-11-33-17-7-9-28(3)10-8-17/h12-13,17,22H,5-11H2,1-4H3 |
| InChIKey | PGRFAUBJFXTXLR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|