C30H36N2O — CID 46179630
2-anilino-1-(2-benzylpiperidin-1-yl)-2-(4-tert-butylphenyl)ethanone (PubChem CID 46179630) has the molecular formula C30H36N2O and a molecular weight of 440.63 g/mol. Its IUPAC name is 2-anilino-1-(2-benzylpiperidin-1-yl)-2-(4-tert-butylphenyl)ethanone.
| Compound Name | 2-anilino-1-(2-benzylpiperidin-1-yl)-2-(4-tert-butylphenyl)ethanone |
|---|---|
| PubChem CID | 46179630 |
| Molecular Formula | C30H36N2O |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 2-anilino-1-(2-benzylpiperidin-1-yl)-2-(4-tert-butylphenyl)ethanone |
| SMILES | CC(C)(C)c1ccc(C(Nc2ccccc2)C(=O)N2CCCCC2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C30H36N2O/c1-30(2,3)25-19-17-24(18-20-25)28(31-26-14-8-5-9-15-26)29(33)32-21-11-10-16-27(32)22-23-12-6-4-7-13-23/h4-9,12-15,17-20,27-28,31H,10-11,16,21-22H2,1-3H3 |
| InChIKey | YJBDIQFEMNLIPU-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |