C24H22F3N3O — CID 46178982
2-anilino-1-(2-pyridin-2-ylpyrrolidin-1-yl)-2-[4-(trifluoromethyl)phenyl]ethanone (PubChem CID 46178982) has the molecular formula C24H22F3N3O and a molecular weight of 425.45 g/mol. Its IUPAC name is 2-anilino-1-(2-pyridin-2-ylpyrrolidin-1-yl)-2-[4-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2-anilino-1-(2-pyridin-2-ylpyrrolidin-1-yl)-2-[4-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 46178982 |
| Molecular Formula | C24H22F3N3O |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 2-anilino-1-(2-pyridin-2-ylpyrrolidin-1-yl)-2-[4-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(C(Nc1ccccc1)c1ccc(C(F)(F)F)cc1)N1CCCC1c1ccccn1 |
| InChI | InChI=1S/C24H22F3N3O/c25-24(26,27)18-13-11-17(12-14-18)22(29-19-7-2-1-3-8-19)23(31)30-16-6-10-21(30)20-9-4-5-15-28-20/h1-5,7-9,11-15,21-22,29H,6,10,16H2 |
| InChIKey | BAXADMOYUBYLMH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |