C18H28F2O4 — CID 46180342
(2S)-3,3-difluoro-2-[(2R,3S,4R,5S)-2-hydroxy-4-methoxy-3,5,8-trimethylnon-7-enyl]-2H-pyran-6-one (PubChem CID 46180342) has the molecular formula C18H28F2O4 and a molecular weight of 346.41 g/mol. Its IUPAC name is (2S)-3,3-difluoro-2-[(2R,3S,4R,5S)-2-hydroxy-4-methoxy-3,5,8-trimethylnon-7-enyl]-2H-pyran-6-one.
| Compound Name | (2S)-3,3-difluoro-2-[(2R,3S,4R,5S)-2-hydroxy-4-methoxy-3,5,8-trimethylnon-7-enyl]-2H-pyran-6-one |
|---|---|
| PubChem CID | 46180342 |
| Molecular Formula | C18H28F2O4 |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (2S)-3,3-difluoro-2-[(2R,3S,4R,5S)-2-hydroxy-4-methoxy-3,5,8-trimethylnon-7-enyl]-2H-pyran-6-one |
| SMILES | CO[C@@H]([C@@H](C)[C@H](O)C[C@@H]1OC(=O)C=CC1(F)F)[C@@H](C)CC=C(C)C |
| InChI | InChI=1S/C18H28F2O4/c1-11(2)6-7-12(3)17(23-5)13(4)14(21)10-15-18(19,20)9-8-16(22)24-15/h6,8-9,12-15,17,21H,7,10H2,1-5H3/t12-,13-,14+,15-,17+/m0/s1 |
| InChIKey | YHPKEKOAKSAARX-KSXIZUIISA-N |
| XLogP | 3.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|