C28H37NO7 — CID 46180494
(3R,4R,5R)-2-benzyl-3-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-phenylmethoxyoxazinan-5-ol (PubChem CID 46180494) has the molecular formula C28H37NO7 and a molecular weight of 499.60 g/mol. Its IUPAC name is (3R,4R,5R)-2-benzyl-3-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-phenylmethoxyoxazinan-5-ol.
| Compound Name | (3R,4R,5R)-2-benzyl-3-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-phenylmethoxyoxazinan-5-ol |
|---|---|
| PubChem CID | 46180494 |
| Molecular Formula | C28H37NO7 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | (3R,4R,5R)-2-benzyl-3-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-phenylmethoxyoxazinan-5-ol |
| SMILES | CC1(C)O[C@H]([C@H]2[C@@H](OCc3ccccc3)[C@H](O)CON2Cc2ccccc2)[C@@H]([C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C28H37NO7/c1-27(2)32-18-22(34-27)25-26(36-28(3,4)35-25)23-24(31-16-20-13-9-6-10-14-20)21(30)17-33-29(23)15-19-11-7-5-8-12-19/h5-14,21-26,30H,15-18H2,1-4H3/t21-,22-,23-,24+,25-,26-/m1/s1 |
| InChIKey | GSFOOKVYUFESHD-JMLBKQIVSA-N |
| XLogP | 3.42 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |