C26H28FN3O4S — CID 46181227
[4-[benzyl(dimethylsulfamoyl)amino]-2-fluorophenyl]-(2-phenylmorpholin-4-yl)methanone (PubChem CID 46181227) has the molecular formula C26H28FN3O4S and a molecular weight of 497.59 g/mol. Its IUPAC name is [4-[benzyl(dimethylsulfamoyl)amino]-2-fluorophenyl]-(2-phenylmorpholin-4-yl)methanone.
| Compound Name | [4-[benzyl(dimethylsulfamoyl)amino]-2-fluorophenyl]-(2-phenylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 46181227 |
| Molecular Formula | C26H28FN3O4S |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | [4-[benzyl(dimethylsulfamoyl)amino]-2-fluorophenyl]-(2-phenylmorpholin-4-yl)methanone |
| SMILES | CN(C)S(=O)(=O)N(Cc1ccccc1)c1ccc(C(=O)N2CCOC(c3ccccc3)C2)c(F)c1 |
| InChI | InChI=1S/C26H28FN3O4S/c1-28(2)35(32,33)30(18-20-9-5-3-6-10-20)22-13-14-23(24(27)17-22)26(31)29-15-16-34-25(19-29)21-11-7-4-8-12-21/h3-14,17,25H,15-16,18-19H2,1-2H3 |
| InChIKey | KUVOCNJHGKHSCX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |