C16H11ClN4OS — CID 46181497
1-(3H-benzimidazol-5-yl)-5-(4-chlorophenyl)-4-sulfanylideneimidazolidin-2-one (PubChem CID 46181497) has the molecular formula C16H11ClN4OS and a molecular weight of 342.81 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-5-(4-chlorophenyl)-4-sulfanylideneimidazolidin-2-one.
| Compound Name | 1-(3H-benzimidazol-5-yl)-5-(4-chlorophenyl)-4-sulfanylideneimidazolidin-2-one |
|---|---|
| PubChem CID | 46181497 |
| Molecular Formula | C16H11ClN4OS |
| Molecular Weight | 342.81 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-5-(4-chlorophenyl)-4-sulfanylideneimidazolidin-2-one |
| SMILES | O=C1NC(=S)C(c2ccc(Cl)cc2)N1c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C16H11ClN4OS/c17-10-3-1-9(2-4-10)14-15(23)20-16(22)21(14)11-5-6-12-13(7-11)19-8-18-12/h1-8,14H,(H,18,19)(H,20,22,23) |
| InChIKey | XPTXSMOWEGMJQC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.81 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|