C26H25FN2O4 — CID 46182294
1-(4-fluorophenyl)-3-[2-[(4-methoxyphenyl)methoxymethyl]-2-methylchromen-6-yl]urea (PubChem CID 46182294) has the molecular formula C26H25FN2O4 and a molecular weight of 448.49 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[2-[(4-methoxyphenyl)methoxymethyl]-2-methylchromen-6-yl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[2-[(4-methoxyphenyl)methoxymethyl]-2-methylchromen-6-yl]urea |
|---|---|
| PubChem CID | 46182294 |
| Molecular Formula | C26H25FN2O4 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[2-[(4-methoxyphenyl)methoxymethyl]-2-methylchromen-6-yl]urea |
| SMILES | COc1ccc(COCC2(C)C=Cc3cc(NC(=O)Nc4ccc(F)cc4)ccc3O2)cc1 |
| InChI | InChI=1S/C26H25FN2O4/c1-26(17-32-16-18-3-10-23(31-2)11-4-18)14-13-19-15-22(9-12-24(19)33-26)29-25(30)28-21-7-5-20(27)6-8-21/h3-15H,16-17H2,1-2H3,(H2,28,29,30) |
| InChIKey | VOWGTLYKSZSLKT-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |