C30H39N5OS — CID 46182984
N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-4-pyridin-2-ylbenzamide (PubChem CID 46182984) has the molecular formula C30H39N5OS and a molecular weight of 517.74 g/mol. Its IUPAC name is N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-4-pyridin-2-ylbenzamide.
| Compound Name | N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-4-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 46182984 |
| Molecular Formula | C30H39N5OS |
| Molecular Weight | 517.74 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-4-pyridin-2-ylbenzamide |
| SMILES | CCCN(CCC1CCC(NC(=O)c2ccc(-c3ccccn3)cc2)CC1)[C@H]1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C30H39N5OS/c1-2-18-35(25-14-15-27-28(20-25)37-30(31)34-27)19-16-21-6-12-24(13-7-21)33-29(36)23-10-8-22(9-11-23)26-5-3-4-17-32-26/h3-5,8-11,17,21,24-25H,2,6-7,12-16,18-20H2,1H3,(H2,31,34)(H,33,36)/t21?,24?,25-/m0/s1 |
| InChIKey | CGLHAMYPNKMXHR-MTQWGCILSA-N |
| XLogP | 5.74 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.74 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |