C27H27Cl2N7O4S — CID 46183142
(NZ)-N-[1-[benzoyl-[tert-butyl-(4-chlorobenzoyl)amino]amino]sulfanyl-3-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]nitramide (PubChem CID 46183142) has the molecular formula C27H27Cl2N7O4S and a molecular weight of 616.53 g/mol. Its IUPAC name is (NZ)-N-[1-[benzoyl-[tert-butyl-(4-chlorobenzoyl)amino]amino]sulfanyl-3-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]nitramide.
| Compound Name | (NZ)-N-[1-[benzoyl-[tert-butyl-(4-chlorobenzoyl)amino]amino]sulfanyl-3-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]nitramide |
|---|---|
| PubChem CID | 46183142 |
| Molecular Formula | C27H27Cl2N7O4S |
| Molecular Weight | 616.53 g/mol |
| Exact Mass | 615.12 |
| IUPAC Name | (NZ)-N-[1-[benzoyl-[tert-butyl-(4-chlorobenzoyl)amino]amino]sulfanyl-3-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]nitramide |
| SMILES | CC(C)(C)N(C(=O)c1ccc(Cl)cc1)N(SN1CCN(Cc2ccc(Cl)nc2)/C1=N/[N+](=O)[O-])C(=O)c1ccccc1 |
| InChI | InChI=1S/C27H27Cl2N7O4S/c1-27(2,3)34(24(37)21-10-12-22(28)13-11-21)35(25(38)20-7-5-4-6-8-20)41-33-16-15-32(26(33)31-36(39)40)18-19-9-14-23(29)30-17-19/h4-14,17H,15-16,18H2,1-3H3/b31-26- |
| InChIKey | RYHZLYCJLZPTBL-ZXPTYKNPSA-N |
| XLogP | 5.62 |
| TPSA | 115.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|