C27H37FN4OS — CID 46184410
(E)-N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-3-(2-fluorophenyl)prop-2-enamide (PubChem CID 46184410) has the molecular formula C27H37FN4OS and a molecular weight of 484.69 g/mol. Its IUPAC name is (E)-N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-3-(2-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-3-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 46184410 |
| Molecular Formula | C27H37FN4OS |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | (E)-N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-3-(2-fluorophenyl)prop-2-enamide |
| SMILES | CCCN(CCC1CCC(NC(=O)/C=C/c2ccccc2F)CC1)[C@H]1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C27H37FN4OS/c1-2-16-32(22-12-13-24-25(18-22)34-27(29)31-24)17-15-19-7-10-21(11-8-19)30-26(33)14-9-20-5-3-4-6-23(20)28/h3-6,9,14,19,21-22H,2,7-8,10-13,15-18H2,1H3,(H2,29,31)(H,30,33)/b14-9+/t19?,21?,22-/m0/s1 |
| InChIKey | ZKLBUJICCUTCQT-VJJXPMQZSA-N |
| XLogP | 5.21 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|