C52H48O3 — CID 46184796
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-methoxynaphthalen-1-yl)-3,4,5,6-tetraphenylbenzoate (PubChem CID 46184796) has the molecular formula C52H48O3 and a molecular weight of 720.95 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-methoxynaphthalen-1-yl)-3,4,5,6-tetraphenylbenzoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-methoxynaphthalen-1-yl)-3,4,5,6-tetraphenylbenzoate |
|---|---|
| PubChem CID | 46184796 |
| Molecular Formula | C52H48O3 |
| Molecular Weight | 720.95 g/mol |
| Exact Mass | 720.36 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-methoxynaphthalen-1-yl)-3,4,5,6-tetraphenylbenzoate |
| SMILES | COc1ccc2ccccc2c1-c1c(C(=O)O[C@@H]2C[C@H](C)CC[C@H]2C(C)C)c(-c2ccccc2)c(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C52H48O3/c1-34(2)41-31-29-35(3)33-44(41)55-52(53)51-48(40-26-15-8-16-27-40)46(38-22-11-6-12-23-38)45(37-20-9-5-10-21-37)47(39-24-13-7-14-25-39)50(51)49-42-28-18-17-19-36(42)30-32-43(49)54-4/h5-28,30,32,34-35,41,44H,29,31,33H2,1-4H3/t35-,41+,44-/m1/s1 |
| InChIKey | LQZYKPGFCBDPED-REMRPFBRSA-N |
| XLogP | 13.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.95 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |