C31H32O3S — CID 10767216
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl]sulfanylformate (PubChem CID 10767216) has the molecular formula C31H32O3S and a molecular weight of 484.66 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl]sulfanylformate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl]sulfanylformate |
|---|---|
| PubChem CID | 10767216 |
| Molecular Formula | C31H32O3S |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl]sulfanylformate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)Sc1ccc2ccccc2c1-c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C31H32O3S/c1-19(2)23-15-12-20(3)18-27(23)34-31(33)35-28-17-14-22-9-5-7-11-25(22)30(28)29-24-10-6-4-8-21(24)13-16-26(29)32/h4-11,13-14,16-17,19-20,23,27,32H,12,15,18H2,1-3H3/t20-,23+,27-/m1/s1 |
| InChIKey | XAOAXKORZMTNHH-PCGJDWNTSA-N |
| XLogP | 9.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|