C32H34O3S — CID 10929175
[1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] 2-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]sulfanylacetate (PubChem CID 10929175) has the molecular formula C32H34O3S and a molecular weight of 498.69 g/mol. Its IUPAC name is [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] 2-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]sulfanylacetate.
| Compound Name | [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] 2-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]sulfanylacetate |
|---|---|
| PubChem CID | 10929175 |
| Molecular Formula | C32H34O3S |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | [1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl] 2-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]sulfanylacetate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@@H]1SCC(=O)Oc1ccc2ccccc2c1-c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C32H34O3S/c1-20(2)24-15-12-21(3)18-29(24)36-19-30(34)35-28-17-14-23-9-5-7-11-26(23)32(28)31-25-10-6-4-8-22(25)13-16-27(31)33/h4-11,13-14,16-17,20-21,24,29,33H,12,15,18-19H2,1-3H3/t21-,24+,29+/m1/s1 |
| InChIKey | YBBCMVHOWFEXDT-JICQUXPRSA-N |
| XLogP | 8.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|