C32H39FN2O2 — CID 46185711
methyl 5-(4-benzhydrylpiperazin-1-yl)-2-(4-fluorophenyl)-2-propan-2-ylpentanoate (PubChem CID 46185711) has the molecular formula C32H39FN2O2 and a molecular weight of 502.67 g/mol. Its IUPAC name is methyl 5-(4-benzhydrylpiperazin-1-yl)-2-(4-fluorophenyl)-2-propan-2-ylpentanoate.
| Compound Name | methyl 5-(4-benzhydrylpiperazin-1-yl)-2-(4-fluorophenyl)-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 46185711 |
| Molecular Formula | C32H39FN2O2 |
| Molecular Weight | 502.67 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | methyl 5-(4-benzhydrylpiperazin-1-yl)-2-(4-fluorophenyl)-2-propan-2-ylpentanoate |
| SMILES | COC(=O)C(CCCN1CCN(C(c2ccccc2)c2ccccc2)CC1)(c1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C32H39FN2O2/c1-25(2)32(31(36)37-3,28-15-17-29(33)18-16-28)19-10-20-34-21-23-35(24-22-34)30(26-11-6-4-7-12-26)27-13-8-5-9-14-27/h4-9,11-18,25,30H,10,19-24H2,1-3H3 |
| InChIKey | ZYEPGOPSUBOERQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.67 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |