C22H25N7O2 — CID 46185746
1,3,3-trimethyl-6-[[5-[(3-oxopiperazin-1-yl)methyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]indol-2-one (PubChem CID 46185746) has the molecular formula C22H25N7O2 and a molecular weight of 419.49 g/mol. Its IUPAC name is 1,3,3-trimethyl-6-[[5-[(3-oxopiperazin-1-yl)methyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]indol-2-one.
| Compound Name | 1,3,3-trimethyl-6-[[5-[(3-oxopiperazin-1-yl)methyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]indol-2-one |
|---|---|
| PubChem CID | 46185746 |
| Molecular Formula | C22H25N7O2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 1,3,3-trimethyl-6-[[5-[(3-oxopiperazin-1-yl)methyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]indol-2-one |
| SMILES | CN1C(=O)C(C)(C)c2ccc(Nc3nc4cccc(CN5CCNC(=O)C5)n4n3)cc21 |
| InChI | InChI=1S/C22H25N7O2/c1-22(2)16-8-7-14(11-17(16)27(3)20(22)31)24-21-25-18-6-4-5-15(29(18)26-21)12-28-10-9-23-19(30)13-28/h4-8,11H,9-10,12-13H2,1-3H3,(H,23,30)(H,24,26) |
| InChIKey | KRAGZLUPZSWXNT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 94.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |