C28H38N6OS — CID 46185942
N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-4-imidazol-1-ylbenzamide (PubChem CID 46185942) has the molecular formula C28H38N6OS and a molecular weight of 506.72 g/mol. Its IUPAC name is N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-4-imidazol-1-ylbenzamide.
| Compound Name | N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-4-imidazol-1-ylbenzamide |
|---|---|
| PubChem CID | 46185942 |
| Molecular Formula | C28H38N6OS |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-4-imidazol-1-ylbenzamide |
| SMILES | CCCN(CCC1CCC(NC(=O)c2ccc(-n3ccnc3)cc2)CC1)[C@H]1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C28H38N6OS/c1-2-15-33(24-11-12-25-26(18-24)36-28(29)32-25)16-13-20-3-7-22(8-4-20)31-27(35)21-5-9-23(10-6-21)34-17-14-30-19-34/h5-6,9-10,14,17,19-20,22,24H,2-4,7-8,11-13,15-16,18H2,1H3,(H2,29,32)(H,31,35)/t20?,22?,24-/m0/s1 |
| InChIKey | KABYKDITVKFREO-JVPYDEADSA-N |
| XLogP | 4.86 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |