C21H28O5 — CID 46186116
methyl (1S,2E,6S,8S,11E)-3,8,16-trimethyl-17-oxo-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-triene-12-carboxylate (PubChem CID 46186116) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is methyl (1S,2E,6S,8S,11E)-3,8,16-trimethyl-17-oxo-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-triene-12-carboxylate.
| Compound Name | methyl (1S,2E,6S,8S,11E)-3,8,16-trimethyl-17-oxo-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-triene-12-carboxylate |
|---|---|
| PubChem CID | 46186116 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | methyl (1S,2E,6S,8S,11E)-3,8,16-trimethyl-17-oxo-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-triene-12-carboxylate |
| SMILES | COC(=O)/C1=C/CC[C@]2(C)O[C@H]2CC/C(C)=C/[C@@H]2OC(=O)C(C)=C2CC1 |
| InChI | InChI=1S/C21H28O5/c1-13-7-10-18-21(3,26-18)11-5-6-15(20(23)24-4)8-9-16-14(2)19(22)25-17(16)12-13/h6,12,17-18H,5,7-11H2,1-4H3/b13-12+,15-6+/t17-,18-,21-/m0/s1 |
| InChIKey | FVZTYMRKRHXWEQ-KEIROZFUSA-N |
| XLogP | 3.79 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|